C16H26N2O4SSi — CID 24823051
1-[(2R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-5-oxothian-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 24823051) has the molecular formula C16H26N2O4SSi and a molecular weight of 370.55 g/mol. Its IUPAC name is 1-[(2R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-5-oxothian-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-5-oxothian-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 24823051 |
| Molecular Formula | C16H26N2O4SSi |
| Molecular Weight | 370.55 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 1-[(2R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-5-oxothian-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn([C@H]2C[C@H](O[Si](C)(C)C(C)(C)C)C(=O)CS2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C16H26N2O4SSi/c1-10-8-18(15(21)17-14(10)20)13-7-12(11(19)9-23-13)22-24(5,6)16(2,3)4/h8,12-13H,7,9H2,1-6H3,(H,17,20,21)/t12-,13+/m0/s1 |
| InChIKey | KJHYTOMTIZLCGG-QWHCGFSZSA-N |
| XLogP | 2.44 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.55 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|