C23H43FN2O4SSi2 — CID 177390760
1-[(2R,3R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-(fluoromethyl)thiolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 177390760) has the molecular formula C23H43FN2O4SSi2 and a molecular weight of 518.84 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-(fluoromethyl)thiolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-(fluoromethyl)thiolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 177390760 |
| Molecular Formula | C23H43FN2O4SSi2 |
| Molecular Weight | 518.84 g/mol |
| Exact Mass | 518.25 |
| IUPAC Name | 1-[(2R,3R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-(fluoromethyl)thiolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn([C@@H]2S[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2CF)c(=O)[nH]c1=O |
| InChI | InChI=1S/C23H43FN2O4SSi2/c1-15-13-26(21(28)25-19(15)27)20-16(12-24)18(30-33(10,11)23(5,6)7)17(31-20)14-29-32(8,9)22(2,3)4/h13,16-18,20H,12,14H2,1-11H3,(H,25,27,28)/t16-,17+,18-,20+/m0/s1 |
| InChIKey | CNQDGMBKLDZHOT-HLNWXESRSA-N |
| XLogP | 5.46 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.84 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|