C18H31N2O6PS3Si — CID 150460330
1-[(2R,3R,4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-hydroxy-4-[(2-sulfanylidene-1,3,2λ5-dithiaphospholan-2-yl)oxy]oxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 150460330) has the molecular formula C18H31N2O6PS3Si and a molecular weight of 526.72 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-hydroxy-4-[(2-sulfanylidene-1,3,2λ5-dithiaphospholan-2-yl)oxy]oxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-hydroxy-4-[(2-sulfanylidene-1,3,2λ5-dithiaphospholan-2-yl)oxy]oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 150460330 |
| Molecular Formula | C18H31N2O6PS3Si |
| Molecular Weight | 526.72 g/mol |
| Exact Mass | 526.09 |
| IUPAC Name | 1-[(2R,3R,4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-hydroxy-4-[(2-sulfanylidene-1,3,2λ5-dithiaphospholan-2-yl)oxy]oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn([C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](OP3(=S)SCCS3)[C@H]2O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C18H31N2O6PS3Si/c1-11-9-20(17(23)19-15(11)22)16-13(21)14(26-27(28)29-7-8-30-27)12(25-16)10-24-31(5,6)18(2,3)4/h9,12-14,16,21H,7-8,10H2,1-6H3,(H,19,22,23)/t12-,13-,14-,16-/m1/s1 |
| InChIKey | HPQNTOYLJOBSOB-IXYNUQLISA-N |
| XLogP | 3.21 |
| TPSA | 102.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.72 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|