C18H29N4O5PS3Si — CID 150788830
9-[(2R,4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-[(2-sulfanylidene-1,3,2λ5-dithiaphospholan-2-yl)oxy]oxolan-2-yl]-3H-purine-2,6-dione (PubChem CID 150788830) has the molecular formula C18H29N4O5PS3Si and a molecular weight of 536.71 g/mol. Its IUPAC name is 9-[(2R,4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-[(2-sulfanylidene-1,3,2λ5-dithiaphospholan-2-yl)oxy]oxolan-2-yl]-3H-purine-2,6-dione.
| Compound Name | 9-[(2R,4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-[(2-sulfanylidene-1,3,2λ5-dithiaphospholan-2-yl)oxy]oxolan-2-yl]-3H-purine-2,6-dione |
|---|---|
| PubChem CID | 150788830 |
| Molecular Formula | C18H29N4O5PS3Si |
| Molecular Weight | 536.71 g/mol |
| Exact Mass | 536.08 |
| IUPAC Name | 9-[(2R,4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-[(2-sulfanylidene-1,3,2λ5-dithiaphospholan-2-yl)oxy]oxolan-2-yl]-3H-purine-2,6-dione |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](n2cnc3c(=O)[nH]c(=O)[nH]c32)C[C@@H]1OP1(=S)SCCS1 |
| InChI | InChI=1S/C18H29N4O5PS3Si/c1-18(2,3)32(4,5)25-9-12-11(27-28(29)30-6-7-31-28)8-13(26-12)22-10-19-14-15(22)20-17(24)21-16(14)23/h10-13H,6-9H2,1-5H3,(H2,20,21,23,24)/t11-,12+,13+/m0/s1 |
| InChIKey | KDKMDWKSLBCEFH-YNEHKIRRSA-N |
| XLogP | 3.81 |
| TPSA | 111.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.71 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|