C18H30N5O5PS3Si — CID 152712704
2-amino-9-[(2R,3R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-5-[(2-sulfanylidene-1,3,2λ5-dithiaphospholan-2-yl)oxymethyl]oxolan-2-yl]-1H-purin-6-one (PubChem CID 152712704) has the molecular formula C18H30N5O5PS3Si and a molecular weight of 551.73 g/mol. Its IUPAC name is 2-amino-9-[(2R,3R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-5-[(2-sulfanylidene-1,3,2λ5-dithiaphospholan-2-yl)oxymethyl]oxolan-2-yl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[(2R,3R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-5-[(2-sulfanylidene-1,3,2λ5-dithiaphospholan-2-yl)oxymethyl]oxolan-2-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 152712704 |
| Molecular Formula | C18H30N5O5PS3Si |
| Molecular Weight | 551.73 g/mol |
| Exact Mass | 551.09 |
| IUPAC Name | 2-amino-9-[(2R,3R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-5-[(2-sulfanylidene-1,3,2λ5-dithiaphospholan-2-yl)oxymethyl]oxolan-2-yl]-1H-purin-6-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@H](n2cnc3c(=O)[nH]c(N)nc32)O[C@@H]1COP1(=S)SCCS1 |
| InChI | InChI=1S/C18H30N5O5PS3Si/c1-18(2,3)33(4,5)28-13-10(8-26-29(30)31-6-7-32-29)27-16(12(13)24)23-9-20-11-14(23)21-17(19)22-15(11)25/h9-10,12-13,16,24H,6-8H2,1-5H3,(H3,19,21,22,25)/t10-,12-,13-,16-/m1/s1 |
| InChIKey | ZTYDVPBTFGXRTO-XNIJJKJLSA-N |
| XLogP | 3.07 |
| TPSA | 137.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.73 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|