C22H43N7O4Si2 — CID 137059272
2-amino-9-[(2R,3R,4R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydrazinyloxolan-2-yl]-1H-purin-6-one (PubChem CID 137059272) has the molecular formula C22H43N7O4Si2 and a molecular weight of 525.80 g/mol. Its IUPAC name is 2-amino-9-[(2R,3R,4R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydrazinyloxolan-2-yl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[(2R,3R,4R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydrazinyloxolan-2-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 137059272 |
| Molecular Formula | C22H43N7O4Si2 |
| Molecular Weight | 525.80 g/mol |
| Exact Mass | 525.29 |
| IUPAC Name | 2-amino-9-[(2R,3R,4R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydrazinyloxolan-2-yl]-1H-purin-6-one |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](n2cnc3c(=O)[nH]c(N)nc32)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1NN |
| InChI | InChI=1S/C22H43N7O4Si2/c1-21(2,3)34(7,8)31-11-13-14(28-24)16(33-35(9,10)22(4,5)6)19(32-13)29-12-25-15-17(29)26-20(23)27-18(15)30/h12-14,16,19,28H,11,24H2,1-10H3,(H3,23,26,27,30)/t13-,14-,16-,19-/m1/s1 |
| InChIKey | LIPQAMFGUXQNSG-NPNMTCQASA-N |
| XLogP | 2.84 |
| TPSA | 155.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.80 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|