C15H25N5O3Si — CID 136608592
2-amino-9-[(2R,4S,5R)-5-ethyl-4-methyl-3-trimethylsilyloxyoxolan-2-yl]-1H-purin-6-one (PubChem CID 136608592) has the molecular formula C15H25N5O3Si and a molecular weight of 351.48 g/mol. Its IUPAC name is 2-amino-9-[(2R,4S,5R)-5-ethyl-4-methyl-3-trimethylsilyloxyoxolan-2-yl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[(2R,4S,5R)-5-ethyl-4-methyl-3-trimethylsilyloxyoxolan-2-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 136608592 |
| Molecular Formula | C15H25N5O3Si |
| Molecular Weight | 351.48 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | 2-amino-9-[(2R,4S,5R)-5-ethyl-4-methyl-3-trimethylsilyloxyoxolan-2-yl]-1H-purin-6-one |
| SMILES | CC[C@H]1O[C@@H](n2cnc3c(=O)[nH]c(N)nc32)C(O[Si](C)(C)C)[C@H]1C |
| InChI | InChI=1S/C15H25N5O3Si/c1-6-9-8(2)11(23-24(3,4)5)14(22-9)20-7-17-10-12(20)18-15(16)19-13(10)21/h7-9,11,14H,6H2,1-5H3,(H3,16,18,19,21)/t8-,9+,11?,14+/m0/s1 |
| InChIKey | SLQFRDBDBNYNPJ-HEEPLWROSA-N |
| XLogP | 1.87 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.48 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|