C12H17N5O4 — CID 137081388
2-amino-9-(3,4-dihydroxy-5-propyloxolan-2-yl)-1H-purin-6-one (PubChem CID 137081388) has the molecular formula C12H17N5O4 and a molecular weight of 295.30 g/mol. Its IUPAC name is 2-amino-9-(3,4-dihydroxy-5-propyloxolan-2-yl)-1H-purin-6-one.
| Compound Name | 2-amino-9-(3,4-dihydroxy-5-propyloxolan-2-yl)-1H-purin-6-one |
|---|---|
| PubChem CID | 137081388 |
| Molecular Formula | C12H17N5O4 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | 2-amino-9-(3,4-dihydroxy-5-propyloxolan-2-yl)-1H-purin-6-one |
| SMILES | CCCC1OC(n2cnc3c(=O)[nH]c(N)nc32)C(O)C1O |
| InChI | InChI=1S/C12H17N5O4/c1-2-3-5-7(18)8(19)11(21-5)17-4-14-6-9(17)15-12(13)16-10(6)20/h4-5,7-8,11,18-19H,2-3H2,1H3,(H3,13,15,16,20) |
| InChIKey | UYXJKMAFHXHWCN-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 139.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |