C12H13N5O5 — CID 136622416
2-amino-9-[(2R,3S,4S,5R)-5-(ethynoxymethyl)-3,4-dihydroxyoxolan-2-yl]-1H-purin-6-one (PubChem CID 136622416) has the molecular formula C12H13N5O5 and a molecular weight of 307.27 g/mol. Its IUPAC name is 2-amino-9-[(2R,3S,4S,5R)-5-(ethynoxymethyl)-3,4-dihydroxyoxolan-2-yl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[(2R,3S,4S,5R)-5-(ethynoxymethyl)-3,4-dihydroxyoxolan-2-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 136622416 |
| Molecular Formula | C12H13N5O5 |
| Molecular Weight | 307.27 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | 2-amino-9-[(2R,3S,4S,5R)-5-(ethynoxymethyl)-3,4-dihydroxyoxolan-2-yl]-1H-purin-6-one |
| SMILES | C#COC[C@H]1O[C@@H](n2cnc3c(=O)[nH]c(N)nc32)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H13N5O5/c1-2-21-3-5-7(18)8(19)11(22-5)17-4-14-6-9(17)15-12(13)16-10(6)20/h1,4-5,7-8,11,18-19H,3H2,(H3,13,15,16,20)/t5-,7-,8+,11-/m1/s1 |
| InChIKey | MZGKDYXXRUFUPL-ICQCTTRCSA-N |
| XLogP | -2.07 |
| TPSA | 148.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.27 |
| LogP ≤ 5 | -2.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|