C10H14N5NaO8P — CID 135887834
CID 135887834 (PubChem CID 135887834) has the molecular formula C10H14N5NaO8P and a molecular weight of 386.21 g/mol.
| Compound Name | CID 135887834 |
|---|---|
| PubChem CID | 135887834 |
| Molecular Formula | C10H14N5NaO8P |
| Molecular Weight | 386.21 g/mol |
| Exact Mass | 386.05 |
| IUPAC Name | — |
| SMILES | Nc1nc2c(ncn2C2OC(COP(=O)(O)O)C(O)C2O)c(=O)[nH]1.[Na] |
| InChI | InChI=1S/C10H14N5O8P.Na/c11-10-13-7-4(8(18)14-10)12-2-15(7)9-6(17)5(16)3(23-9)1-22-24(19,20)21;/h2-3,5-6,9,16-17H,1H2,(H2,19,20,21)(H3,11,13,14,18); |
| InChIKey | DKSVJQGFRWYUAY-UHFFFAOYSA-N |
| XLogP | -2.95 |
| TPSA | 206.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.21 |
| LogP ≤ 5 | -2.95 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|