C10H12Cl2N5O6P — CID 136849103
2-amino-9-[(2R,3R,4S,5R)-5-(dichlorophosphoryloxymethyl)-3,4-dihydroxyoxolan-2-yl]-1H-purin-6-one (PubChem CID 136849103) has the molecular formula C10H12Cl2N5O6P and a molecular weight of 400.12 g/mol. Its IUPAC name is 2-amino-9-[(2R,3R,4S,5R)-5-(dichlorophosphoryloxymethyl)-3,4-dihydroxyoxolan-2-yl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[(2R,3R,4S,5R)-5-(dichlorophosphoryloxymethyl)-3,4-dihydroxyoxolan-2-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 136849103 |
| Molecular Formula | C10H12Cl2N5O6P |
| Molecular Weight | 400.12 g/mol |
| Exact Mass | 398.99 |
| IUPAC Name | 2-amino-9-[(2R,3R,4S,5R)-5-(dichlorophosphoryloxymethyl)-3,4-dihydroxyoxolan-2-yl]-1H-purin-6-one |
| SMILES | Nc1nc2c(ncn2[C@@H]2O[C@H](COP(=O)(Cl)Cl)[C@@H](O)[C@H]2O)c(=O)[nH]1 |
| InChI | InChI=1S/C10H12Cl2N5O6P/c11-24(12,21)22-1-3-5(18)6(19)9(23-3)17-2-14-4-7(17)15-10(13)16-8(4)20/h2-3,5-6,9,18-19H,1H2,(H3,13,15,16,20)/t3-,5-,6-,9-/m1/s1 |
| InChIKey | VDJSGTSYFPNRBV-UUOKFMHZSA-N |
| XLogP | -0.08 |
| TPSA | 165.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.12 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|