C11H13F3N5O7P — CID 135976349
[(2R,3S,4R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-(trifluoromethyl)phosphinic acid (PubChem CID 135976349) has the molecular formula C11H13F3N5O7P and a molecular weight of 415.22 g/mol. Its IUPAC name is [(2R,3S,4R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-(trifluoromethyl)phosphinic acid.
| Compound Name | [(2R,3S,4R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-(trifluoromethyl)phosphinic acid |
|---|---|
| PubChem CID | 135976349 |
| Molecular Formula | C11H13F3N5O7P |
| Molecular Weight | 415.22 g/mol |
| Exact Mass | 415.05 |
| IUPAC Name | [(2R,3S,4R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-(trifluoromethyl)phosphinic acid |
| SMILES | Nc1nc2c(ncn2C2O[C@H](COP(=O)(O)C(F)(F)F)[C@@H](O)[C@H]2O)c(=O)[nH]1 |
| InChI | InChI=1S/C11H13F3N5O7P/c12-11(13,14)27(23,24)25-1-3-5(20)6(21)9(26-3)19-2-16-4-7(19)17-10(15)18-8(4)22/h2-3,5-6,9,20-21H,1H2,(H,23,24)(H3,15,17,18,22)/t3-,5-,6-,9?/m1/s1 |
| InChIKey | CPGRJVITWRYEPR-LZGMGDPASA-N |
| XLogP | -0.96 |
| TPSA | 185.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.22 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|