C10H16N6O10P2 — CID 135479029
[[5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxyphosphonamidic acid (PubChem CID 135479029) has the molecular formula C10H16N6O10P2 and a molecular weight of 442.22 g/mol. Its IUPAC name is [[5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxyphosphonamidic acid.
| Compound Name | [[5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxyphosphonamidic acid |
|---|---|
| PubChem CID | 135479029 |
| Molecular Formula | C10H16N6O10P2 |
| Molecular Weight | 442.22 g/mol |
| Exact Mass | 442.04 |
| IUPAC Name | [[5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxyphosphonamidic acid |
| SMILES | Nc1nc2c(ncn2C2OC(COP(=O)(O)OP(N)(=O)O)C(O)C2O)c(=O)[nH]1 |
| InChI | InChI=1S/C10H16N6O10P2/c11-10-14-7-4(8(19)15-10)13-2-16(7)9-6(18)5(17)3(25-9)1-24-28(22,23)26-27(12,20)21/h2-3,5-6,9,17-18H,1H2,(H,22,23)(H3,12,20,21)(H3,11,14,15,19) |
| InChIKey | ZGPDMUBRWRJAQQ-UHFFFAOYSA-N |
| XLogP | -2.49 |
| TPSA | 258.36 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.22 |
| LogP ≤ 5 | -2.49 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|