C10H13Li2N5O11P2 — CID 169493921
dilithium;[[(2R,4S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxy(2,3,4,5-13C4)oxolan-2-yl](113C)methoxy-hydroxyphosphoryl] phosphate (PubChem CID 169493921) has the molecular formula C10H13Li2N5O11P2 and a molecular weight of 464.99 g/mol. Its IUPAC name is dilithium;[[(2R,4S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxy(2,3,4,5-13C4)oxolan-2-yl](113C)methoxy-hydroxyphosphoryl] phosphate.
| Compound Name | dilithium;[[(2R,4S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxy(2,3,4,5-13C4)oxolan-2-yl](113C)methoxy-hydroxyphosphoryl] phosphate |
|---|---|
| PubChem CID | 169493921 |
| Molecular Formula | C10H13Li2N5O11P2 |
| Molecular Weight | 464.99 g/mol |
| Exact Mass | 465.07 |
| IUPAC Name | dilithium;[[(2R,4S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxy(2,3,4,5-13C4)oxolan-2-yl](113C)methoxy-hydroxyphosphoryl] phosphate |
| SMILES | N[13c]1n[13c]2[13c](n[13cH]n2[13C@@H]2O[13C@H]([13CH2]OP(=O)(O)OP(=O)([O-])[O-])[13CH](O)[13C@@H]2O)[13c](=O)[nH]1.[Li+].[Li+] |
| InChI | InChI=1S/C10H15N5O11P2.2Li/c11-10-13-7-4(8(18)14-10)12-2-15(7)9-6(17)5(16)3(25-9)1-24-28(22,23)26-27(19,20)21;;/h2-3,5-6,9,16-17H,1H2,(H,22,23)(H2,19,20,21)(H3,11,13,14,18);;/q;2*+1/p-2/t3-,5?,6+,9-;;/m1../s1/i1+1,2+1,3+1,4+1,5+1,6+1,7+1,8+1,9+1,10+1;; |
| InChIKey | AYHHBIHQJFJWSB-NBLUMDJUSA-L |
| XLogP | -9.71 |
| TPSA | 258.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.99 |
| LogP ≤ 5 | -9.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|