C10H13N5O7P+ — CID 135566260
[(2R,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxy-oxophosphanium (PubChem CID 135566260) has the molecular formula C10H13N5O7P+ and a molecular weight of 346.22 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxy-oxophosphanium.
| Compound Name | [(2R,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 135566260 |
| Molecular Formula | C10H13N5O7P+ |
| Molecular Weight | 346.22 g/mol |
| Exact Mass | 346.05 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxy-oxophosphanium |
| SMILES | Nc1nc2c(ncn2[C@@H]2O[C@H](CO[P+](=O)O)[C@@H](O)[C@H]2O)c(=O)[nH]1 |
| InChI | InChI=1S/C10H12N5O7P/c11-10-13-7-4(8(18)14-10)12-2-15(7)9-6(17)5(16)3(22-9)1-21-23(19)20/h2-3,5-6,9,16-17H,1H2,(H3-,11,13,14,18,19,20)/p+1/t3-,5-,6-,9-/m1/s1 |
| InChIKey | RDELXJWFNWPMMG-UUOKFMHZSA-O |
| XLogP | -2.01 |
| TPSA | 185.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.22 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|