C10H12N5O8P — CID 135460969
2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-[(3-oxo-1,2,3λ5-dioxaphosphiran-3-yl)oxymethyl]oxolan-2-yl]-1H-purin-6-one (PubChem CID 135460969) has the molecular formula C10H12N5O8P and a molecular weight of 361.21 g/mol. Its IUPAC name is 2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-[(3-oxo-1,2,3λ5-dioxaphosphiran-3-yl)oxymethyl]oxolan-2-yl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-[(3-oxo-1,2,3λ5-dioxaphosphiran-3-yl)oxymethyl]oxolan-2-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 135460969 |
| Molecular Formula | C10H12N5O8P |
| Molecular Weight | 361.21 g/mol |
| Exact Mass | 361.04 |
| IUPAC Name | 2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-[(3-oxo-1,2,3λ5-dioxaphosphiran-3-yl)oxymethyl]oxolan-2-yl]-1H-purin-6-one |
| SMILES | Nc1nc2c(ncn2[C@@H]2O[C@H](COP3(=O)OO3)[C@@H](O)[C@H]2O)c(=O)[nH]1 |
| InChI | InChI=1S/C10H12N5O8P/c11-10-13-7-4(8(18)14-10)12-2-15(7)9-6(17)5(16)3(21-9)1-20-24(19)22-23-24/h2-3,5-6,9,16-17H,1H2,(H3,11,13,14,18)/t3-,5-,6-,9-/m1/s1 |
| InChIKey | DXEWYUYNUDOHKJ-UUOKFMHZSA-N |
| XLogP | -1.59 |
| TPSA | 190.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.21 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|