C11H13N5O6 — CID 137148910
[(2R,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl formate (PubChem CID 137148910) has the molecular formula C11H13N5O6 and a molecular weight of 311.25 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl formate.
| Compound Name | [(2R,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl formate |
|---|---|
| PubChem CID | 137148910 |
| Molecular Formula | C11H13N5O6 |
| Molecular Weight | 311.25 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl formate |
| SMILES | Nc1nc2c(ncn2[C@@H]2O[C@H](COC=O)[C@@H](O)[C@H]2O)c(=O)[nH]1 |
| InChI | InChI=1S/C11H13N5O6/c12-11-14-8-5(9(20)15-11)13-2-16(8)10-7(19)6(18)4(22-10)1-21-3-17/h2-4,6-7,10,18-19H,1H2,(H3,12,14,15,20)/t4-,6-,7-,10-/m1/s1 |
| InChIKey | GPRCAQFPKSDWAD-KQYNXXCUSA-N |
| XLogP | -2.51 |
| TPSA | 165.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.25 |
| LogP ≤ 5 | -2.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|