C13H15N5O8 — CID 135513774
3-[[(2R,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-3-oxopropanoic acid (PubChem CID 135513774) has the molecular formula C13H15N5O8 and a molecular weight of 369.29 g/mol. Its IUPAC name is 3-[[(2R,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-3-oxopropanoic acid.
| Compound Name | 3-[[(2R,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 135513774 |
| Molecular Formula | C13H15N5O8 |
| Molecular Weight | 369.29 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | 3-[[(2R,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-3-oxopropanoic acid |
| SMILES | Nc1nc2c(ncn2[C@@H]2O[C@H](COC(=O)CC(=O)O)[C@@H](O)[C@H]2O)c(=O)[nH]1 |
| InChI | InChI=1S/C13H15N5O8/c14-13-16-10-7(11(24)17-13)15-3-18(10)12-9(23)8(22)4(26-12)2-25-6(21)1-5(19)20/h3-4,8-9,12,22-23H,1-2H2,(H,19,20)(H3,14,16,17,24)/t4-,8-,9-,12-/m1/s1 |
| InChIKey | DLVPCDPLJVTXDE-VXPJVLCTSA-N |
| XLogP | -2.66 |
| TPSA | 202.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.29 |
| LogP ≤ 5 | -2.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|