C16H19N5O11 — CID 175032512
2-[2-[[(2R,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-1-hydroxy-2-oxoethyl]butanedioic acid (PubChem CID 175032512) has the molecular formula C16H19N5O11 and a molecular weight of 457.35 g/mol. Its IUPAC name is 2-[2-[[(2R,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-1-hydroxy-2-oxoethyl]butanedioic acid.
| Compound Name | 2-[2-[[(2R,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-1-hydroxy-2-oxoethyl]butanedioic acid |
|---|---|
| PubChem CID | 175032512 |
| Molecular Formula | C16H19N5O11 |
| Molecular Weight | 457.35 g/mol |
| Exact Mass | 457.11 |
| IUPAC Name | 2-[2-[[(2R,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-1-hydroxy-2-oxoethyl]butanedioic acid |
| SMILES | Nc1nc2c(ncn2[C@@H]2O[C@H](COC(=O)C(O)C(CC(=O)O)C(=O)O)[C@@H](O)[C@H]2O)c(=O)[nH]1 |
| InChI | InChI=1S/C16H19N5O11/c17-16-19-11-7(12(27)20-16)18-3-21(11)13-10(26)9(25)5(32-13)2-31-15(30)8(24)4(14(28)29)1-6(22)23/h3-5,8-10,13,24-26H,1-2H2,(H,22,23)(H,28,29)(H3,17,19,20,27)/t4?,5-,8?,9-,10-,13-/m1/s1 |
| InChIKey | VGXLTSURCWWOLA-JKXHVRNLSA-N |
| XLogP | -3.60 |
| TPSA | 260.41 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.35 |
| LogP ≤ 5 | -3.60 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |