C10H13N7O7P+ — CID 137183501
[(2R,5R)-5-[2-(aminodiazenyl)-6-oxo-1H-purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxy-oxophosphanium (PubChem CID 137183501) has the molecular formula C10H13N7O7P+ and a molecular weight of 374.23 g/mol. Its IUPAC name is [(2R,5R)-5-[2-(aminodiazenyl)-6-oxo-1H-purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxy-oxophosphanium.
| Compound Name | [(2R,5R)-5-[2-(aminodiazenyl)-6-oxo-1H-purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 137183501 |
| Molecular Formula | C10H13N7O7P+ |
| Molecular Weight | 374.23 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | [(2R,5R)-5-[2-(aminodiazenyl)-6-oxo-1H-purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxy-oxophosphanium |
| SMILES | NN=Nc1nc2c(ncn2[C@@H]2O[C@H](CO[P+](=O)O)C(O)C2O)c(=O)[nH]1 |
| InChI | InChI=1S/C10H12N7O7P/c11-16-15-10-13-7-4(8(20)14-10)12-2-17(7)9-6(19)5(18)3(24-9)1-23-25(21)22/h2-3,5-6,9,18-19H,1H2,(H3-,11,13,14,15,20,21,22)/p+1/t3-,5?,6?,9-/m1/s1 |
| InChIKey | JMHIYQBFCVSAKK-VKJDSPIKSA-O |
| XLogP | -1.64 |
| TPSA | 210.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.23 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|