C12H18N5O7P — CID 163578547
[(5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-2-ethyl-4-methoxyoxolan-3-yl] dihydrogen phosphate (PubChem CID 163578547) has the molecular formula C12H18N5O7P and a molecular weight of 375.28 g/mol. Its IUPAC name is [(5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-2-ethyl-4-methoxyoxolan-3-yl] dihydrogen phosphate.
| Compound Name | [(5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-2-ethyl-4-methoxyoxolan-3-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 163578547 |
| Molecular Formula | C12H18N5O7P |
| Molecular Weight | 375.28 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | [(5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-2-ethyl-4-methoxyoxolan-3-yl] dihydrogen phosphate |
| SMILES | CCC1O[C@@H](n2cnc3c(=O)[nH]c(N)nc32)C(OC)C1OP(=O)(O)O |
| InChI | InChI=1S/C12H18N5O7P/c1-3-5-7(24-25(19,20)21)8(22-2)11(23-5)17-4-14-6-9(17)15-12(13)16-10(6)18/h4-5,7-8,11H,3H2,1-2H3,(H2,19,20,21)(H3,13,15,16,18)/t5?,7?,8?,11-/m1/s1 |
| InChIKey | GFPHZSSEXRGAKW-DFKYELRASA-N |
| XLogP | -0.50 |
| TPSA | 174.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.28 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|