C10H14N5Na2O8P — CID 137179828
CID 137179828 (PubChem CID 137179828) has the molecular formula C10H14N5Na2O8P and a molecular weight of 409.20 g/mol.
| Compound Name | CID 137179828 |
|---|---|
| PubChem CID | 137179828 |
| Molecular Formula | C10H14N5Na2O8P |
| Molecular Weight | 409.20 g/mol |
| Exact Mass | 409.04 |
| IUPAC Name | — |
| SMILES | Nc1nc2c(ncn2[C@@H]2O[C@H](CO)[C@@H](OP(=O)(O)O)[C@H]2O)c(=O)[nH]1.[Na].[Na] |
| InChI | InChI=1S/C10H14N5O8P.2Na/c11-10-13-7-4(8(18)14-10)12-2-15(7)9-5(17)6(3(1-16)22-9)23-24(19,20)21;;/h2-3,5-6,9,16-17H,1H2,(H2,19,20,21)(H3,11,13,14,18);;/t3-,5-,6-,9-;;/m1../s1 |
| InChIKey | CGQAIYAEMBAVGK-LGVAUZIVSA-N |
| XLogP | -3.33 |
| TPSA | 206.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.20 |
| LogP ≤ 5 | -3.33 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|