C10H13FN5O8P — CID 155784041
[(2R,3R,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-4-fluorooxy-2-(hydroxymethyl)oxolan-3-yl] dihydrogen phosphate (PubChem CID 155784041) has the molecular formula C10H13FN5O8P and a molecular weight of 381.21 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-4-fluorooxy-2-(hydroxymethyl)oxolan-3-yl] dihydrogen phosphate.
| Compound Name | [(2R,3R,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-4-fluorooxy-2-(hydroxymethyl)oxolan-3-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 155784041 |
| Molecular Formula | C10H13FN5O8P |
| Molecular Weight | 381.21 g/mol |
| Exact Mass | 381.05 |
| IUPAC Name | [(2R,3R,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-4-fluorooxy-2-(hydroxymethyl)oxolan-3-yl] dihydrogen phosphate |
| SMILES | Nc1nc2c(ncn2[C@@H]2O[C@H](CO)[C@@H](OP(=O)(O)O)[C@H]2OF)c(=O)[nH]1 |
| InChI | InChI=1S/C10H13FN5O8P/c11-23-6-5(24-25(19,20)21)3(1-17)22-9(6)16-2-13-4-7(16)14-10(12)15-8(4)18/h2-3,5-6,9,17H,1H2,(H2,19,20,21)(H3,12,14,15,18)/t3-,5-,6-,9-/m1/s1 |
| InChIKey | DJHSHTTWAJOAEQ-UUOKFMHZSA-N |
| XLogP | -1.66 |
| TPSA | 195.04 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.21 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|