C11H15ClN5O7P — CID 170458687
[(2R,3R,4R,5S)-2-(2-amino-6-oxo-1H-purin-9-yl)-5-(chloromethyl)-4-methoxyoxolan-3-yl] dihydrogen phosphate (PubChem CID 170458687) has the molecular formula C11H15ClN5O7P and a molecular weight of 395.70 g/mol. Its IUPAC name is [(2R,3R,4R,5S)-2-(2-amino-6-oxo-1H-purin-9-yl)-5-(chloromethyl)-4-methoxyoxolan-3-yl] dihydrogen phosphate.
| Compound Name | [(2R,3R,4R,5S)-2-(2-amino-6-oxo-1H-purin-9-yl)-5-(chloromethyl)-4-methoxyoxolan-3-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 170458687 |
| Molecular Formula | C11H15ClN5O7P |
| Molecular Weight | 395.70 g/mol |
| Exact Mass | 395.04 |
| IUPAC Name | [(2R,3R,4R,5S)-2-(2-amino-6-oxo-1H-purin-9-yl)-5-(chloromethyl)-4-methoxyoxolan-3-yl] dihydrogen phosphate |
| SMILES | CO[C@H]1[C@@H](OP(=O)(O)O)[C@H](n2cnc3c(=O)[nH]c(N)nc32)O[C@@H]1CCl |
| InChI | InChI=1S/C11H15ClN5O7P/c1-22-6-4(2-12)23-10(7(6)24-25(19,20)21)17-3-14-5-8(17)15-11(13)16-9(5)18/h3-4,6-7,10H,2H2,1H3,(H2,19,20,21)(H3,13,15,16,18)/t4-,6-,7-,10-/m1/s1 |
| InChIKey | IKEOREKXGUMVDC-KQYNXXCUSA-N |
| XLogP | -0.67 |
| TPSA | 174.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.70 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|