C15H24N5O8P — CID 173465350
[(2R,3S,5S)-5-(2-amino-6-oxo-1H-purin-9-yl)-2-ethyl-4-(2-methoxyethoxy)oxolan-3-yl] methyl hydrogen phosphate (PubChem CID 173465350) has the molecular formula C15H24N5O8P and a molecular weight of 433.36 g/mol. Its IUPAC name is [(2R,3S,5S)-5-(2-amino-6-oxo-1H-purin-9-yl)-2-ethyl-4-(2-methoxyethoxy)oxolan-3-yl] methyl hydrogen phosphate.
| Compound Name | [(2R,3S,5S)-5-(2-amino-6-oxo-1H-purin-9-yl)-2-ethyl-4-(2-methoxyethoxy)oxolan-3-yl] methyl hydrogen phosphate |
|---|---|
| PubChem CID | 173465350 |
| Molecular Formula | C15H24N5O8P |
| Molecular Weight | 433.36 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | [(2R,3S,5S)-5-(2-amino-6-oxo-1H-purin-9-yl)-2-ethyl-4-(2-methoxyethoxy)oxolan-3-yl] methyl hydrogen phosphate |
| SMILES | CC[C@H]1O[C@H](n2cnc3c(=O)[nH]c(N)nc32)C(OCCOC)[C@H]1OP(=O)(O)OC |
| InChI | InChI=1S/C15H24N5O8P/c1-4-8-10(28-29(22,23)25-3)11(26-6-5-24-2)14(27-8)20-7-17-9-12(20)18-15(16)19-13(9)21/h7-8,10-11,14H,4-6H2,1-3H3,(H,22,23)(H3,16,18,19,21)/t8-,10+,11?,14+/m1/s1 |
| InChIKey | LZIIUOGLJUWJPS-KUDRMYDWSA-N |
| XLogP | 0.17 |
| TPSA | 173.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.36 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|