C13H21N6O6P — CID 177366134
[(2R,4S,5R)-5-(2,6-diaminopurin-9-yl)-2-ethyl-4-methoxyoxolan-3-yl] methyl hydrogen phosphate (PubChem CID 177366134) has the molecular formula C13H21N6O6P and a molecular weight of 388.32 g/mol. Its IUPAC name is [(2R,4S,5R)-5-(2,6-diaminopurin-9-yl)-2-ethyl-4-methoxyoxolan-3-yl] methyl hydrogen phosphate.
| Compound Name | [(2R,4S,5R)-5-(2,6-diaminopurin-9-yl)-2-ethyl-4-methoxyoxolan-3-yl] methyl hydrogen phosphate |
|---|---|
| PubChem CID | 177366134 |
| Molecular Formula | C13H21N6O6P |
| Molecular Weight | 388.32 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | [(2R,4S,5R)-5-(2,6-diaminopurin-9-yl)-2-ethyl-4-methoxyoxolan-3-yl] methyl hydrogen phosphate |
| SMILES | CC[C@H]1O[C@@H](n2cnc3c(N)nc(N)nc32)[C@@H](OC)C1OP(=O)(O)OC |
| InChI | InChI=1S/C13H21N6O6P/c1-4-6-8(25-26(20,21)23-3)9(22-2)12(24-6)19-5-16-7-10(14)17-13(15)18-11(7)19/h5-6,8-9,12H,4H2,1-3H3,(H,20,21)(H4,14,15,17,18)/t6-,8?,9+,12-/m1/s1 |
| InChIKey | HKEYXGLEYUEANM-WURNFRPNSA-N |
| XLogP | 0.45 |
| TPSA | 169.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.32 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|