C21H19F17N5O6P — CID 162569232
[(2R,5R)-2-ethyl-5-[6-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylamino)purin-9-yl]-4-methoxyoxolan-3-yl] methyl hydrogen phosphate (PubChem CID 162569232) has the molecular formula C21H19F17N5O6P and a molecular weight of 791.35 g/mol. Its IUPAC name is [(2R,5R)-2-ethyl-5-[6-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylamino)purin-9-yl]-4-methoxyoxolan-3-yl] methyl hydrogen phosphate.
| Compound Name | [(2R,5R)-2-ethyl-5-[6-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylamino)purin-9-yl]-4-methoxyoxolan-3-yl] methyl hydrogen phosphate |
|---|---|
| PubChem CID | 162569232 |
| Molecular Formula | C21H19F17N5O6P |
| Molecular Weight | 791.35 g/mol |
| Exact Mass | 791.08 |
| IUPAC Name | [(2R,5R)-2-ethyl-5-[6-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylamino)purin-9-yl]-4-methoxyoxolan-3-yl] methyl hydrogen phosphate |
| SMILES | CC[C@H]1O[C@@H](n2cnc3c(NC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)ncnc32)C(OC)C1OP(=O)(O)OC |
| InChI | InChI=1S/C21H19F17N5O6P/c1-4-7-9(49-50(44,45)47-3)10(46-2)13(48-7)43-6-41-8-11(39-5-40-12(8)43)42-21(37,38)19(32,33)17(28,29)15(24,25)14(22,23)16(26,27)18(30,31)20(34,35)36/h5-7,9-10,13H,4H2,1-3H3,(H,44,45)(H,39,40,42)/t7-,9?,10?,13-/m1/s1 |
| InChIKey | BQHQGNKYFFEXBO-QQNFCMCUSA-N |
| XLogP | 6.66 |
| TPSA | 129.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.35 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|