C31H31N5O6P+ — CID 153285987
[(2R,4S,5R)-3,4-dimethoxy-5-[6-(tritylamino)purin-9-yl]oxolan-2-yl]methoxy-hydroxy-oxophosphanium (PubChem CID 153285987) has the molecular formula C31H31N5O6P+ and a molecular weight of 600.59 g/mol. Its IUPAC name is [(2R,4S,5R)-3,4-dimethoxy-5-[6-(tritylamino)purin-9-yl]oxolan-2-yl]methoxy-hydroxy-oxophosphanium.
| Compound Name | [(2R,4S,5R)-3,4-dimethoxy-5-[6-(tritylamino)purin-9-yl]oxolan-2-yl]methoxy-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 153285987 |
| Molecular Formula | C31H31N5O6P+ |
| Molecular Weight | 600.59 g/mol |
| Exact Mass | 600.20 |
| IUPAC Name | [(2R,4S,5R)-3,4-dimethoxy-5-[6-(tritylamino)purin-9-yl]oxolan-2-yl]methoxy-hydroxy-oxophosphanium |
| SMILES | COC1[C@@H](CO[P+](=O)O)O[C@@H](n2cnc3c(NC(c4ccccc4)(c4ccccc4)c4ccccc4)ncnc32)[C@H]1OC |
| InChI | InChI=1S/C31H30N5O6P/c1-39-26-24(18-41-43(37)38)42-30(27(26)40-2)36-20-34-25-28(32-19-33-29(25)36)35-31(21-12-6-3-7-13-21,22-14-8-4-9-15-22)23-16-10-5-11-17-23/h3-17,19-20,24,26-27,30H,18H2,1-2H3,(H-,32,33,35,37,38)/p+1/t24-,26?,27+,30-/m1/s1 |
| InChIKey | OVRJZPCYUBOFNT-DHEKLMLGSA-O |
| XLogP | 4.82 |
| TPSA | 129.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.59 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|