C71H63N5O6 — CID 23257034
2-[2-[(2R,3R,4R,5R)-5-[6-(tritylamino)purin-9-yl]-4-trityloxy-2-(trityloxymethyl)oxolan-3-yl]oxyethoxy]ethanol (PubChem CID 23257034) has the molecular formula C71H63N5O6 and a molecular weight of 1082.31 g/mol. Its IUPAC name is 2-[2-[(2R,3R,4R,5R)-5-[6-(tritylamino)purin-9-yl]-4-trityloxy-2-(trityloxymethyl)oxolan-3-yl]oxyethoxy]ethanol.
| Compound Name | 2-[2-[(2R,3R,4R,5R)-5-[6-(tritylamino)purin-9-yl]-4-trityloxy-2-(trityloxymethyl)oxolan-3-yl]oxyethoxy]ethanol |
|---|---|
| PubChem CID | 23257034 |
| Molecular Formula | C71H63N5O6 |
| Molecular Weight | 1082.31 g/mol |
| Exact Mass | 1081.48 |
| IUPAC Name | 2-[2-[(2R,3R,4R,5R)-5-[6-(tritylamino)purin-9-yl]-4-trityloxy-2-(trityloxymethyl)oxolan-3-yl]oxyethoxy]ethanol |
| SMILES | OCCOCCO[C@H]1[C@@H](OC(c2ccccc2)(c2ccccc2)c2ccccc2)[C@H](n2cnc3c(NC(c4ccccc4)(c4ccccc4)c4ccccc4)ncnc32)O[C@@H]1COC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C71H63N5O6/c77-46-47-78-48-49-79-64-62(50-80-70(56-34-16-4-17-35-56,57-36-18-5-19-37-57)58-38-20-6-21-39-58)81-68(65(64)82-71(59-40-22-7-23-41-59,60-42-24-8-25-43-60)61-44-26-9-27-45-61)76-52-74-63-66(72-51-73-67(63)76)75-69(53-28-10-1-11-29-53,54-30-12-2-13-31-54)55-32-14-3-15-33-55/h1-45,51-52,62,64-65,68,77H,46-50H2,(H,72,73,75)/t62-,64-,65-,68-/m1/s1 |
| InChIKey | NFJSEBOFIKJPQA-KUPDPNSOSA-N |
| XLogP | 12.91 |
| TPSA | 122.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 82 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1082.31 |
| LogP ≤ 5 | 12.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|