C38H39N5O7 — CID 102187641
[(2R,3R,4R,5R)-3,4-di(propanoyloxy)-5-[6-(tritylamino)purin-9-yl]oxolan-2-yl]methyl propanoate (PubChem CID 102187641) has the molecular formula C38H39N5O7 and a molecular weight of 677.76 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4-di(propanoyloxy)-5-[6-(tritylamino)purin-9-yl]oxolan-2-yl]methyl propanoate.
| Compound Name | [(2R,3R,4R,5R)-3,4-di(propanoyloxy)-5-[6-(tritylamino)purin-9-yl]oxolan-2-yl]methyl propanoate |
|---|---|
| PubChem CID | 102187641 |
| Molecular Formula | C38H39N5O7 |
| Molecular Weight | 677.76 g/mol |
| Exact Mass | 677.28 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4-di(propanoyloxy)-5-[6-(tritylamino)purin-9-yl]oxolan-2-yl]methyl propanoate |
| SMILES | CCC(=O)OC[C@H]1O[C@@H](n2cnc3c(NC(c4ccccc4)(c4ccccc4)c4ccccc4)ncnc32)[C@H](OC(=O)CC)[C@@H]1OC(=O)CC |
| InChI | InChI=1S/C38H39N5O7/c1-4-29(44)47-22-28-33(49-30(45)5-2)34(50-31(46)6-3)37(48-28)43-24-41-32-35(39-23-40-36(32)43)42-38(25-16-10-7-11-17-25,26-18-12-8-13-19-26)27-20-14-9-15-21-27/h7-21,23-24,28,33-34,37H,4-6,22H2,1-3H3,(H,39,40,42)/t28-,33-,34-,37-/m1/s1 |
| InChIKey | UAQPMDYKWPRJMU-RJZNYRSSSA-N |
| XLogP | 5.72 |
| TPSA | 143.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.76 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|