C37H37N6O7P — CID 174156874
[(2R,4S,5R)-4-acetyloxy-2-[[2-cyanoethoxy(methyl)phosphanyl]oxymethyl]-5-[6-(tritylamino)purin-9-yl]oxolan-3-yl] acetate (PubChem CID 174156874) has the molecular formula C37H37N6O7P and a molecular weight of 708.71 g/mol. Its IUPAC name is [(2R,4S,5R)-4-acetyloxy-2-[[2-cyanoethoxy(methyl)phosphanyl]oxymethyl]-5-[6-(tritylamino)purin-9-yl]oxolan-3-yl] acetate.
| Compound Name | [(2R,4S,5R)-4-acetyloxy-2-[[2-cyanoethoxy(methyl)phosphanyl]oxymethyl]-5-[6-(tritylamino)purin-9-yl]oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 174156874 |
| Molecular Formula | C37H37N6O7P |
| Molecular Weight | 708.71 g/mol |
| Exact Mass | 708.25 |
| IUPAC Name | [(2R,4S,5R)-4-acetyloxy-2-[[2-cyanoethoxy(methyl)phosphanyl]oxymethyl]-5-[6-(tritylamino)purin-9-yl]oxolan-3-yl] acetate |
| SMILES | CC(=O)OC1[C@@H](COP(C)OCCC#N)O[C@@H](n2cnc3c(NC(c4ccccc4)(c4ccccc4)c4ccccc4)ncnc32)[C@H]1OC(C)=O |
| InChI | InChI=1S/C37H37N6O7P/c1-25(44)48-32-30(22-47-51(3)46-21-13-20-38)50-36(33(32)49-26(2)45)43-24-41-31-34(39-23-40-35(31)43)42-37(27-14-7-4-8-15-27,28-16-9-5-10-17-28)29-18-11-6-12-19-29/h4-12,14-19,23-24,30,32-33,36H,13,21-22H2,1-3H3,(H,39,40,42)/t30-,32?,33+,36-,51?/m1/s1 |
| InChIKey | BPVHXYJNNQZYDG-DPNPJARPSA-N |
| XLogP | 5.88 |
| TPSA | 159.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.71 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|