C23H23N5O8 — CID 11785268
[(2R,3R,4R,5R)-3,4-diacetyloxy-5-(6-benzamidopurin-9-yl)oxolan-2-yl]methyl acetate (PubChem CID 11785268) has the molecular formula C23H23N5O8 and a molecular weight of 497.46 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4-diacetyloxy-5-(6-benzamidopurin-9-yl)oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-(6-benzamidopurin-9-yl)oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 11785268 |
| Molecular Formula | C23H23N5O8 |
| Molecular Weight | 497.46 g/mol |
| Exact Mass | 497.15 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-(6-benzamidopurin-9-yl)oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2cnc3c(NC(=O)c4ccccc4)ncnc32)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C23H23N5O8/c1-12(29)33-9-16-18(34-13(2)30)19(35-14(3)31)23(36-16)28-11-26-17-20(24-10-25-21(17)28)27-22(32)15-7-5-4-6-8-15/h4-8,10-11,16,18-19,23H,9H2,1-3H3,(H,24,25,27,32)/t16-,18-,19-,23-/m1/s1 |
| InChIKey | AVWLAAMRGGKGRS-DYVMYPEFSA-N |
| XLogP | 1.40 |
| TPSA | 160.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.46 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|