C18H21N5O8 — CID 101134697
[(2S,3S,4S,5S)-5-(6-acetamidopurin-9-yl)-3,4-diacetyloxyoxolan-2-yl]methyl acetate (PubChem CID 101134697) has the molecular formula C18H21N5O8 and a molecular weight of 435.39 g/mol. Its IUPAC name is [(2S,3S,4S,5S)-5-(6-acetamidopurin-9-yl)-3,4-diacetyloxyoxolan-2-yl]methyl acetate.
| Compound Name | [(2S,3S,4S,5S)-5-(6-acetamidopurin-9-yl)-3,4-diacetyloxyoxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 101134697 |
| Molecular Formula | C18H21N5O8 |
| Molecular Weight | 435.39 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | [(2S,3S,4S,5S)-5-(6-acetamidopurin-9-yl)-3,4-diacetyloxyoxolan-2-yl]methyl acetate |
| SMILES | CC(=O)Nc1ncnc2c1ncn2[C@H]1O[C@@H](COC(C)=O)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C18H21N5O8/c1-8(24)22-16-13-17(20-6-19-16)23(7-21-13)18-15(30-11(4)27)14(29-10(3)26)12(31-18)5-28-9(2)25/h6-7,12,14-15,18H,5H2,1-4H3,(H,19,20,22,24)/t12-,14-,15-,18-/m0/s1 |
| InChIKey | ZSEXHHLPZKJKHA-OWCBBSPXSA-N |
| XLogP | 0.11 |
| TPSA | 160.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.39 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|