C20H27N5O7 — CID 11730055
[(2R,3R,4R,5R)-3,4-diacetyloxy-5-[6-(diethylamino)purin-9-yl]oxolan-2-yl]methyl acetate (PubChem CID 11730055) has the molecular formula C20H27N5O7 and a molecular weight of 449.46 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4-diacetyloxy-5-[6-(diethylamino)purin-9-yl]oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-[6-(diethylamino)purin-9-yl]oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 11730055 |
| Molecular Formula | C20H27N5O7 |
| Molecular Weight | 449.46 g/mol |
| Exact Mass | 449.19 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-[6-(diethylamino)purin-9-yl]oxolan-2-yl]methyl acetate |
| SMILES | CCN(CC)c1ncnc2c1ncn2[C@@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C20H27N5O7/c1-6-24(7-2)18-15-19(22-9-21-18)25(10-23-15)20-17(31-13(5)28)16(30-12(4)27)14(32-20)8-29-11(3)26/h9-10,14,16-17,20H,6-8H2,1-5H3/t14-,16-,17-,20-/m1/s1 |
| InChIKey | YRVNBEQXIXRUQB-WVSUBDOOSA-N |
| XLogP | 1.00 |
| TPSA | 134.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.46 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|