C22H26N4O7 — CID 102145311
[(2R,3R,4R,5R)-3,4-diacetyloxy-5-(6-hex-1-ynylpurin-9-yl)oxolan-2-yl]methyl acetate (PubChem CID 102145311) has the molecular formula C22H26N4O7 and a molecular weight of 458.47 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4-diacetyloxy-5-(6-hex-1-ynylpurin-9-yl)oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-(6-hex-1-ynylpurin-9-yl)oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 102145311 |
| Molecular Formula | C22H26N4O7 |
| Molecular Weight | 458.47 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-(6-hex-1-ynylpurin-9-yl)oxolan-2-yl]methyl acetate |
| SMILES | CCCCC#Cc1ncnc2c1ncn2[C@@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C22H26N4O7/c1-5-6-7-8-9-16-18-21(24-11-23-16)26(12-25-18)22-20(32-15(4)29)19(31-14(3)28)17(33-22)10-30-13(2)27/h11-12,17,19-20,22H,5-7,10H2,1-4H3/t17-,19-,20-,22-/m1/s1 |
| InChIKey | ZBQAMVUHHPOSGD-JWUVWSEFSA-N |
| XLogP | 1.69 |
| TPSA | 131.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.47 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|