C15H17ClN4O5 — CID 121443516
[(2R,3S,5R)-4-acetyloxy-5-(6-chloropurin-9-yl)-2-ethyloxolan-3-yl] acetate (PubChem CID 121443516) has the molecular formula C15H17ClN4O5 and a molecular weight of 368.78 g/mol. Its IUPAC name is [(2R,3S,5R)-4-acetyloxy-5-(6-chloropurin-9-yl)-2-ethyloxolan-3-yl] acetate.
| Compound Name | [(2R,3S,5R)-4-acetyloxy-5-(6-chloropurin-9-yl)-2-ethyloxolan-3-yl] acetate |
|---|---|
| PubChem CID | 121443516 |
| Molecular Formula | C15H17ClN4O5 |
| Molecular Weight | 368.78 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | [(2R,3S,5R)-4-acetyloxy-5-(6-chloropurin-9-yl)-2-ethyloxolan-3-yl] acetate |
| SMILES | CC[C@H]1O[C@@H](n2cnc3c(Cl)ncnc32)C(OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C15H17ClN4O5/c1-4-9-11(23-7(2)21)12(24-8(3)22)15(25-9)20-6-19-10-13(16)17-5-18-14(10)20/h5-6,9,11-12,15H,4H2,1-3H3/t9-,11+,12?,15-/m1/s1 |
| InChIKey | CJSXFYSFGARPDL-WABSSEDKSA-N |
| XLogP | 1.65 |
| TPSA | 105.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.78 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |