C15H17Cl2N3O3 — CID 130438335
[(2R,3R,4R,5R)-2-(5,7-dichloroimidazo[4,5-b]pyridin-3-yl)-5-ethyl-4-methyloxolan-3-yl] acetate (PubChem CID 130438335) has the molecular formula C15H17Cl2N3O3 and a molecular weight of 358.23 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-2-(5,7-dichloroimidazo[4,5-b]pyridin-3-yl)-5-ethyl-4-methyloxolan-3-yl] acetate.
| Compound Name | [(2R,3R,4R,5R)-2-(5,7-dichloroimidazo[4,5-b]pyridin-3-yl)-5-ethyl-4-methyloxolan-3-yl] acetate |
|---|---|
| PubChem CID | 130438335 |
| Molecular Formula | C15H17Cl2N3O3 |
| Molecular Weight | 358.23 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | [(2R,3R,4R,5R)-2-(5,7-dichloroimidazo[4,5-b]pyridin-3-yl)-5-ethyl-4-methyloxolan-3-yl] acetate |
| SMILES | CC[C@H]1O[C@@H](n2cnc3c(Cl)cc(Cl)nc32)[C@H](OC(C)=O)[C@@H]1C |
| InChI | InChI=1S/C15H17Cl2N3O3/c1-4-10-7(2)13(22-8(3)21)15(23-10)20-6-18-12-9(16)5-11(17)19-14(12)20/h5-7,10,13,15H,4H2,1-3H3/t7-,10-,13-,15-/m1/s1 |
| InChIKey | UIWVJHXMDKPXNH-ZEJIMRTRSA-N |
| XLogP | 3.61 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.23 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|