C17H18ClN3O7 — CID 15476653
[(2R,3R,4R,5R)-3,4-diacetyloxy-5-(7-chloroimidazo[4,5-b]pyridin-3-yl)oxolan-2-yl]methyl acetate (PubChem CID 15476653) has the molecular formula C17H18ClN3O7 and a molecular weight of 411.80 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4-diacetyloxy-5-(7-chloroimidazo[4,5-b]pyridin-3-yl)oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-(7-chloroimidazo[4,5-b]pyridin-3-yl)oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 15476653 |
| Molecular Formula | C17H18ClN3O7 |
| Molecular Weight | 411.80 g/mol |
| Exact Mass | 411.08 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-(7-chloroimidazo[4,5-b]pyridin-3-yl)oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2cnc3c(Cl)ccnc32)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C17H18ClN3O7/c1-8(22)25-6-12-14(26-9(2)23)15(27-10(3)24)17(28-12)21-7-20-13-11(18)4-5-19-16(13)21/h4-5,7,12,14-15,17H,6H2,1-3H3/t12-,14-,15-,17-/m1/s1 |
| InChIKey | ZCUWPIGBPNCIJW-DNNBLBMLSA-N |
| XLogP | 1.41 |
| TPSA | 118.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.80 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|