C17H20N4O7 — CID 10249924
[(2R,3R,4R,5R)-3,4-diacetyloxy-5-(6-methylpurin-9-yl)oxolan-2-yl]methyl acetate (PubChem CID 10249924) has the molecular formula C17H20N4O7 and a molecular weight of 392.37 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4-diacetyloxy-5-(6-methylpurin-9-yl)oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-(6-methylpurin-9-yl)oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 10249924 |
| Molecular Formula | C17H20N4O7 |
| Molecular Weight | 392.37 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-(6-methylpurin-9-yl)oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2cnc3c(C)ncnc32)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C17H20N4O7/c1-8-13-16(19-6-18-8)21(7-20-13)17-15(27-11(4)24)14(26-10(3)23)12(28-17)5-25-9(2)22/h6-7,12,14-15,17H,5H2,1-4H3/t12-,14-,15-,17-/m1/s1 |
| InChIKey | OLGDOWZBOORTRW-DNNBLBMLSA-N |
| XLogP | 0.46 |
| TPSA | 131.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.37 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|