C17H19BrN4O7 — CID 89143012
[(2R,5R)-3,4-diacetyloxy-5-(2-bromo-6-methylpurin-9-yl)oxolan-2-yl]methyl acetate (PubChem CID 89143012) has the molecular formula C17H19BrN4O7 and a molecular weight of 471.26 g/mol. Its IUPAC name is [(2R,5R)-3,4-diacetyloxy-5-(2-bromo-6-methylpurin-9-yl)oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,5R)-3,4-diacetyloxy-5-(2-bromo-6-methylpurin-9-yl)oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 89143012 |
| Molecular Formula | C17H19BrN4O7 |
| Molecular Weight | 471.26 g/mol |
| Exact Mass | 470.04 |
| IUPAC Name | [(2R,5R)-3,4-diacetyloxy-5-(2-bromo-6-methylpurin-9-yl)oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2cnc3c(C)nc(Br)nc32)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C17H19BrN4O7/c1-7-12-15(21-17(18)20-7)22(6-19-12)16-14(28-10(4)25)13(27-9(3)24)11(29-16)5-26-8(2)23/h6,11,13-14,16H,5H2,1-4H3/t11-,13?,14?,16-/m1/s1 |
| InChIKey | AVXJQLKTZPKJPR-JIFUTNICSA-N |
| XLogP | 1.22 |
| TPSA | 131.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.26 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|