C21H24BrN5O8 — CID 11548522
[(2R,3R,4R,5R)-3,4-diacetyloxy-5-[2-[acetyl(prop-2-enyl)amino]-6-bromopurin-9-yl]oxolan-2-yl]methyl acetate (PubChem CID 11548522) has the molecular formula C21H24BrN5O8 and a molecular weight of 554.35 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4-diacetyloxy-5-[2-[acetyl(prop-2-enyl)amino]-6-bromopurin-9-yl]oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-[2-[acetyl(prop-2-enyl)amino]-6-bromopurin-9-yl]oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 11548522 |
| Molecular Formula | C21H24BrN5O8 |
| Molecular Weight | 554.35 g/mol |
| Exact Mass | 553.08 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-[2-[acetyl(prop-2-enyl)amino]-6-bromopurin-9-yl]oxolan-2-yl]methyl acetate |
| SMILES | C=CCN(C(C)=O)c1nc(Br)c2ncn([C@@H]3O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H]3OC(C)=O)c2n1 |
| InChI | InChI=1S/C21H24BrN5O8/c1-6-7-26(10(2)28)21-24-18(22)15-19(25-21)27(9-23-15)20-17(34-13(5)31)16(33-12(4)30)14(35-20)8-32-11(3)29/h6,9,14,16-17,20H,1,7-8H2,2-5H3/t14-,16-,17-,20-/m1/s1 |
| InChIKey | BPHLZZLIYLNPDD-WVSUBDOOSA-N |
| XLogP | 1.45 |
| TPSA | 152.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.35 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|