C16H18N4O8 — CID 171699525
[(4S)-3,4-diacetyloxy-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methyl acetate (PubChem CID 171699525) has the molecular formula C16H18N4O8 and a molecular weight of 394.34 g/mol. Its IUPAC name is [(4S)-3,4-diacetyloxy-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methyl acetate.
| Compound Name | [(4S)-3,4-diacetyloxy-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 171699525 |
| Molecular Formula | C16H18N4O8 |
| Molecular Weight | 394.34 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | [(4S)-3,4-diacetyloxy-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(n2cnc3c(=O)[nH]cnc32)[C@@H](OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C16H18N4O8/c1-7(21)25-4-10-12(26-8(2)22)13(27-9(3)23)16(28-10)20-6-19-11-14(20)17-5-18-15(11)24/h5-6,10,12-13,16H,4H2,1-3H3,(H,17,18,24)/t10?,12?,13-,16?/m0/s1 |
| InChIKey | SFEQTFDQPJQUJM-ODAIIWTHSA-N |
| XLogP | -0.56 |
| TPSA | 151.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.34 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|