C17H20N4O8 — CID 136842924
[(2S,3S,4S,5S,6R)-4,5-diacetyloxy-2-methyl-6-(6-oxo-1H-purin-9-yl)oxan-3-yl] acetate (PubChem CID 136842924) has the molecular formula C17H20N4O8 and a molecular weight of 408.37 g/mol. Its IUPAC name is [(2S,3S,4S,5S,6R)-4,5-diacetyloxy-2-methyl-6-(6-oxo-1H-purin-9-yl)oxan-3-yl] acetate.
| Compound Name | [(2S,3S,4S,5S,6R)-4,5-diacetyloxy-2-methyl-6-(6-oxo-1H-purin-9-yl)oxan-3-yl] acetate |
|---|---|
| PubChem CID | 136842924 |
| Molecular Formula | C17H20N4O8 |
| Molecular Weight | 408.37 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | [(2S,3S,4S,5S,6R)-4,5-diacetyloxy-2-methyl-6-(6-oxo-1H-purin-9-yl)oxan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@@H](OC(C)=O)[C@H](C)O[C@@H](n2cnc3c(=O)[nH]cnc32)[C@H]1OC(C)=O |
| InChI | InChI=1S/C17H20N4O8/c1-7-12(27-8(2)22)13(28-9(3)23)14(29-10(4)24)17(26-7)21-6-20-11-15(21)18-5-19-16(11)25/h5-7,12-14,17H,1-4H3,(H,18,19,25)/t7-,12-,13-,14-,17+/m0/s1 |
| InChIKey | CUGASDHZRKHJKF-WYNKBTPXSA-N |
| XLogP | -0.17 |
| TPSA | 151.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.37 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|