C21H25N3O9 — CID 53242829
methyl 5-methyl-3-[(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-methyloxan-2-yl]imidazo[4,5-b]pyridine-7-carboxylate (PubChem CID 53242829) has the molecular formula C21H25N3O9 and a molecular weight of 463.44 g/mol. Its IUPAC name is methyl 5-methyl-3-[(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-methyloxan-2-yl]imidazo[4,5-b]pyridine-7-carboxylate.
| Compound Name | methyl 5-methyl-3-[(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-methyloxan-2-yl]imidazo[4,5-b]pyridine-7-carboxylate |
|---|---|
| PubChem CID | 53242829 |
| Molecular Formula | C21H25N3O9 |
| Molecular Weight | 463.44 g/mol |
| Exact Mass | 463.16 |
| IUPAC Name | methyl 5-methyl-3-[(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-methyloxan-2-yl]imidazo[4,5-b]pyridine-7-carboxylate |
| SMILES | COC(=O)c1cc(C)nc2c1ncn2[C@@H]1O[C@@H](C)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C21H25N3O9/c1-9-7-14(21(28)29-6)15-19(23-9)24(8-22-15)20-18(33-13(5)27)17(32-12(4)26)16(10(2)30-20)31-11(3)25/h7-8,10,16-18,20H,1-6H3/t10-,16-,17+,18+,20+/m0/s1 |
| InChIKey | NGXYLLKMGLPYBU-UDVOHWITSA-N |
| XLogP | 1.24 |
| TPSA | 145.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.44 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|