C19H22N4O6 — CID 158034010
[(2R,3S,5R)-4-acetyloxy-2-ethyl-5-(2-methyl-6-prop-2-ynoxypurin-9-yl)oxolan-3-yl] acetate (PubChem CID 158034010) has the molecular formula C19H22N4O6 and a molecular weight of 402.41 g/mol. Its IUPAC name is [(2R,3S,5R)-4-acetyloxy-2-ethyl-5-(2-methyl-6-prop-2-ynoxypurin-9-yl)oxolan-3-yl] acetate.
| Compound Name | [(2R,3S,5R)-4-acetyloxy-2-ethyl-5-(2-methyl-6-prop-2-ynoxypurin-9-yl)oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 158034010 |
| Molecular Formula | C19H22N4O6 |
| Molecular Weight | 402.41 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | [(2R,3S,5R)-4-acetyloxy-2-ethyl-5-(2-methyl-6-prop-2-ynoxypurin-9-yl)oxolan-3-yl] acetate |
| SMILES | C#CCOc1nc(C)nc2c1ncn2[C@@H]1O[C@H](CC)[C@H](OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C19H22N4O6/c1-6-8-26-18-14-17(21-10(3)22-18)23(9-20-14)19-16(28-12(5)25)15(27-11(4)24)13(7-2)29-19/h1,9,13,15-16,19H,7-8H2,2-5H3/t13-,15+,16?,19-/m1/s1 |
| InChIKey | FHNHCRMQGCEOTO-VXSJHCPZSA-N |
| XLogP | 1.32 |
| TPSA | 114.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.41 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|