C16H19N5O6S — CID 57153738
[(2S,5R)-5-(6-acetamidopurin-9-yl)-4-acetyloxy-2-(sulfanylmethyl)oxolan-3-yl] acetate (PubChem CID 57153738) has the molecular formula C16H19N5O6S and a molecular weight of 409.42 g/mol. Its IUPAC name is [(2S,5R)-5-(6-acetamidopurin-9-yl)-4-acetyloxy-2-(sulfanylmethyl)oxolan-3-yl] acetate.
| Compound Name | [(2S,5R)-5-(6-acetamidopurin-9-yl)-4-acetyloxy-2-(sulfanylmethyl)oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 57153738 |
| Molecular Formula | C16H19N5O6S |
| Molecular Weight | 409.42 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | [(2S,5R)-5-(6-acetamidopurin-9-yl)-4-acetyloxy-2-(sulfanylmethyl)oxolan-3-yl] acetate |
| SMILES | CC(=O)Nc1ncnc2c1ncn2[C@@H]1O[C@H](CS)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C16H19N5O6S/c1-7(22)20-14-11-15(18-5-17-14)21(6-19-11)16-13(26-9(3)24)12(25-8(2)23)10(4-28)27-16/h5-6,10,12-13,16,28H,4H2,1-3H3,(H,17,18,20,22)/t10-,12?,13?,16-/m1/s1 |
| InChIKey | OJOFEFVBJVOEEC-VHBSBENZSA-N |
| XLogP | 0.48 |
| TPSA | 134.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.42 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|