C20H25N5O9 — CID 71207127
[(2R,5S,6R,7R)-2-(6-acetamidopurin-9-yl)-5,6-diacetyloxy-7-(hydroxymethyl)oxepan-4-yl] acetate (PubChem CID 71207127) has the molecular formula C20H25N5O9 and a molecular weight of 479.45 g/mol. Its IUPAC name is [(2R,5S,6R,7R)-2-(6-acetamidopurin-9-yl)-5,6-diacetyloxy-7-(hydroxymethyl)oxepan-4-yl] acetate.
| Compound Name | [(2R,5S,6R,7R)-2-(6-acetamidopurin-9-yl)-5,6-diacetyloxy-7-(hydroxymethyl)oxepan-4-yl] acetate |
|---|---|
| PubChem CID | 71207127 |
| Molecular Formula | C20H25N5O9 |
| Molecular Weight | 479.45 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | [(2R,5S,6R,7R)-2-(6-acetamidopurin-9-yl)-5,6-diacetyloxy-7-(hydroxymethyl)oxepan-4-yl] acetate |
| SMILES | CC(=O)Nc1ncnc2c1ncn2[C@H]1CC(OC(C)=O)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](CO)O1 |
| InChI | InChI=1S/C20H25N5O9/c1-9(27)24-19-16-20(22-7-21-19)25(8-23-16)15-5-13(31-10(2)28)17(32-11(3)29)18(33-12(4)30)14(6-26)34-15/h7-8,13-15,17-18,26H,5-6H2,1-4H3,(H,21,22,24,27)/t13?,14-,15-,17+,18-/m1/s1 |
| InChIKey | XLDHBJWMULGQIG-FFDCSCEMSA-N |
| XLogP | -0.14 |
| TPSA | 181.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.45 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|