C21H23N5O6 — CID 53244322
[(2R,3S,5R)-3-acetyloxy-5-[6-[(2-hydroxyphenyl)methylamino]purin-9-yl]oxolan-2-yl]methyl acetate (PubChem CID 53244322) has the molecular formula C21H23N5O6 and a molecular weight of 441.44 g/mol. Its IUPAC name is [(2R,3S,5R)-3-acetyloxy-5-[6-[(2-hydroxyphenyl)methylamino]purin-9-yl]oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,5R)-3-acetyloxy-5-[6-[(2-hydroxyphenyl)methylamino]purin-9-yl]oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 53244322 |
| Molecular Formula | C21H23N5O6 |
| Molecular Weight | 441.44 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | [(2R,3S,5R)-3-acetyloxy-5-[6-[(2-hydroxyphenyl)methylamino]purin-9-yl]oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2cnc3c(NCc4ccccc4O)ncnc32)C[C@@H]1OC(C)=O |
| InChI | InChI=1S/C21H23N5O6/c1-12(27)30-9-17-16(31-13(2)28)7-18(32-17)26-11-25-19-20(23-10-24-21(19)26)22-8-14-5-3-4-6-15(14)29/h3-6,10-11,16-18,29H,7-9H2,1-2H3,(H,22,23,24)/t16-,17+,18+/m0/s1 |
| InChIKey | PZAWOXZVTFYFNH-RCCFBDPRSA-N |
| XLogP | 1.93 |
| TPSA | 137.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.44 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|