C19H22N5O13P3S — CID 102348816
[(2R,3S,5R)-3-acetyloxy-5-(6-benzamidopurin-9-yl)oxolan-2-yl]methoxy-hydroxy-[hydroxy(phosphonooxy)phosphoryl]oxy-sulfidophosphanium (PubChem CID 102348816) has the molecular formula C19H22N5O13P3S and a molecular weight of 653.40 g/mol. Its IUPAC name is [(2R,3S,5R)-3-acetyloxy-5-(6-benzamidopurin-9-yl)oxolan-2-yl]methoxy-hydroxy-[hydroxy(phosphonooxy)phosphoryl]oxy-sulfidophosphanium.
| Compound Name | [(2R,3S,5R)-3-acetyloxy-5-(6-benzamidopurin-9-yl)oxolan-2-yl]methoxy-hydroxy-[hydroxy(phosphonooxy)phosphoryl]oxy-sulfidophosphanium |
|---|---|
| PubChem CID | 102348816 |
| Molecular Formula | C19H22N5O13P3S |
| Molecular Weight | 653.40 g/mol |
| Exact Mass | 653.01 |
| IUPAC Name | [(2R,3S,5R)-3-acetyloxy-5-(6-benzamidopurin-9-yl)oxolan-2-yl]methoxy-hydroxy-[hydroxy(phosphonooxy)phosphoryl]oxy-sulfidophosphanium |
| SMILES | CC(=O)O[C@H]1C[C@H](n2cnc3c(NC(=O)c4ccccc4)ncnc32)O[C@@H]1CO[P+](O)([S-])OP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C19H22N5O13P3S/c1-11(25)34-13-7-15(35-14(13)8-33-40(32,41)37-39(30,31)36-38(27,28)29)24-10-22-16-17(20-9-21-18(16)24)23-19(26)12-5-3-2-4-6-12/h2-6,9-10,13-15H,7-8H2,1H3,(H,30,31)(H,32,41)(H2,27,28,29)(H,20,21,23,26)/t13-,14+,15+,40?/m0/s1 |
| InChIKey | ICCGJXYTQLSZEJ-GJVYREFNSA-N |
| XLogP | 1.76 |
| TPSA | 250.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.40 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|