C23H32N6O3Si — CID 10434796
N-[9-[(2R,4S,5R)-5-(aminomethyl)-4-[tert-butyl(dimethyl)silyl]oxyoxolan-2-yl]purin-6-yl]benzamide (PubChem CID 10434796) has the molecular formula C23H32N6O3Si and a molecular weight of 468.63 g/mol. Its IUPAC name is N-[9-[(2R,4S,5R)-5-(aminomethyl)-4-[tert-butyl(dimethyl)silyl]oxyoxolan-2-yl]purin-6-yl]benzamide.
| Compound Name | N-[9-[(2R,4S,5R)-5-(aminomethyl)-4-[tert-butyl(dimethyl)silyl]oxyoxolan-2-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 10434796 |
| Molecular Formula | C23H32N6O3Si |
| Molecular Weight | 468.63 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | N-[9-[(2R,4S,5R)-5-(aminomethyl)-4-[tert-butyl(dimethyl)silyl]oxyoxolan-2-yl]purin-6-yl]benzamide |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1C[C@H](n2cnc3c(NC(=O)c4ccccc4)ncnc32)O[C@@H]1CN |
| InChI | InChI=1S/C23H32N6O3Si/c1-23(2,3)33(4,5)32-16-11-18(31-17(16)12-24)29-14-27-19-20(25-13-26-21(19)29)28-22(30)15-9-7-6-8-10-15/h6-10,13-14,16-18H,11-12,24H2,1-5H3,(H,25,26,28,30)/t16-,17+,18+/m0/s1 |
| InChIKey | QLMQNCSYGOFVGQ-RCCFBDPRSA-N |
| XLogP | 3.72 |
| TPSA | 117.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.63 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|